Ethyl 2-(bromomethyl)acrylate - CAS 17435-72-2
Catalog: |
BB013008 |
Product Name: |
Ethyl 2-(bromomethyl)acrylate |
CAS: |
17435-72-2 |
Synonyms: |
ethyl 2-(bromomethyl)prop-2-enoate |
IUPAC Name: | ethyl 2-(bromomethyl)prop-2-enoate |
Description: | Intermediate used for the synthesis of aza inhibitors of chorismate mutase. |
Molecular Weight: | 193.04 |
Molecular Formula: | C6H9BrO2 |
Canonical SMILES: | CCOC(=O)C(=C)CBr |
InChI: | InChI=1S/C6H9BrO2/c1-3-9-6(8)5(2)4-7/h2-4H2,1H3 |
InChI Key: | MTCMFVTVXAOHNQ-UHFFFAOYSA-N |
Boiling Point: | 38 ℃ / 0.8 mmHg (lit.) |
Density: | 1.387 g/cm3 |
Appearance: | Colourless oil |
MDL: | MFCD00031518 |
LogP: | 1.50060 |
GHS Hazard Statement: | H315 (95.24%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021202974-A1 | Hybrid-hydrogels comprising decellularized extracellular matrix | 20200403 |
US-2021309778-A1 | Hydrolysis-tolerant crosslinked polymers from reverse-acrylate multifunctional monomers | 20200326 |
CN-113087700-A | Spirocyclic tetrahydroquinazolines | 20200108 |
US-2021230174-A1 | Spirocyclic tetrahydroquinazolines | 20200108 |
WO-2021139748-A1 | Spirocyclic tetrahydroquinazolines | 20200108 |
PMID | Publication Date | Title | Journal |
16855749 | 20060807 | Synthesis of 4-deoxy-4-nitrosialic acid | Organic & biomolecular chemistry |
15858666 | 20050507 | Synthesis of screening substrates for the directed evolution of sialic acid aldolase: towards tailored enzymes for the preparation of influenza A sialidase inhibitor analogues | Organic & biomolecular chemistry |
12076153 | 20020628 | Reaction of allylzinc reagents and zinc enolates of ketones with alpha-amidoalkylphenyl sulfones | The Journal of organic chemistry |
11950290 | 20020419 | Intramolecular Diels-Alder reactions using alpha-methylene lactones as dienophile | The Journal of organic chemistry |
Complexity: | 120 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 191.97859 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 191.97859 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS