Ethyl 2,4-Dichloro-6-methylpyrimidine-5-carboxylate - CAS 36802-47-8
Catalog: |
BB023082 |
Product Name: |
Ethyl 2,4-Dichloro-6-methylpyrimidine-5-carboxylate |
CAS: |
36802-47-8 |
Synonyms: |
2,4-dichloro-6-methyl-5-pyrimidinecarboxylic acid ethyl ester; ethyl 2,4-dichloro-6-methylpyrimidine-5-carboxylate |
IUPAC Name: | ethyl 2,4-dichloro-6-methylpyrimidine-5-carboxylate |
Description: | Ethyl 2,4-Dichloro-6-methylpyrimidine-5-carboxylate (CAS# 36802-47-8 ) is a useful research chemical. |
Molecular Weight: | 235.07 |
Molecular Formula: | C8H8Cl2N2O2 |
Canonical SMILES: | CCOC(=O)C1=C(N=C(N=C1Cl)Cl)C |
InChI: | InChI=1S/C8H8Cl2N2O2/c1-3-14-7(13)5-4(2)11-8(10)12-6(5)9/h3H2,1-2H3 |
InChI Key: | NBLFZEOAMBXUEI-UHFFFAOYSA-N |
LogP: | 2.26850 |
Publication Number | Title | Priority Date |
WO-2018187294-A1 | Pyrimido-pyridazinone compound combinations, methods, kits and formulations thereof | 20170403 |
CA-2846187-A1 | Pyrimido-pyridazinone compounds and use thereof | 20110823 |
DK-2748166-T3 | Pyrimido-pyridazinon compounds and use thereof | 20110823 |
EP-2748166-A1 | Pyrimido- pyridazinone compounds and use thereof | 20110823 |
EP-2748166-B1 | Pyrimido-pyridazinone compounds and use thereof | 20110823 |
Complexity: | 216 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 233.9962829 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 233.9962829 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 52.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS