Ethyl 2-(4-Aminophenyl)thiazole-4-carboxylate - CAS 730234-73-8
Catalog: |
BB034741 |
Product Name: |
Ethyl 2-(4-Aminophenyl)thiazole-4-carboxylate |
CAS: |
730234-73-8 |
Synonyms: |
2-(4-aminophenyl)-4-thiazolecarboxylic acid ethyl ester; ethyl 2-(4-aminophenyl)-1,3-thiazole-4-carboxylate |
IUPAC Name: | ethyl 2-(4-aminophenyl)-1,3-thiazole-4-carboxylate |
Description: | Ethyl 2-(4-Aminophenyl)thiazole-4-carboxylate (CAS# 730234-73-8) is a useful research chemical. |
Molecular Weight: | 248.30 |
Molecular Formula: | C12H12N2O2S |
Canonical SMILES: | CCOC(=O)C1=CSC(=N1)C2=CC=C(C=C2)N |
InChI: | InChI=1S/C12H12N2O2S/c1-2-16-12(15)10-7-17-11(14-10)8-3-5-9(13)6-4-8/h3-7H,2,13H2,1H3 |
InChI Key: | LZHUXAJBTASELP-UHFFFAOYSA-N |
LogP: | 3.15020 |
Publication Number | Title | Priority Date |
EP-1727808-A2 | Biaryl amino acids and their use in dna binding oligomers | 20040301 |
EP-1727808-B1 | Biaryl amino acids and their use in dna binding oligomers | 20040301 |
EP-1727808-B3 | Biaryl amino acids and their use in dna binding oligomers | 20040301 |
US-2007249591-A1 | Biaryl Amino Acids and Their Use in Dna Binding Oligomers | 20040301 |
US-2011160192-A1 | Biaryl amino acids and their use in dna binding oligomers | 20040301 |
Complexity: | 267 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 248.0619488 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 248.0619488 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 93.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS