Ethyl 2-(3-Fluorophenoxy)acetate - CAS 777-70-8
Catalog: |
BB036028 |
Product Name: |
Ethyl 2-(3-Fluorophenoxy)acetate |
CAS: |
777-70-8 |
Synonyms: |
2-(3-fluorophenoxy)acetic acid ethyl ester; ethyl 2-(3-fluorophenoxy)acetate |
IUPAC Name: | ethyl 2-(3-fluorophenoxy)acetate |
Description: | 2-Chlorobenzyl Azide can be used to treat degenerative diseases. |
Molecular Weight: | 198.19 |
Molecular Formula: | C10H11FO3 |
Canonical SMILES: | CCOC(=O)COC1=CC(=CC=C1)F |
InChI: | InChI=1S/C10H11FO3/c1-2-13-10(12)7-14-9-5-3-4-8(11)6-9/h3-6H,2,7H2,1H3 |
InChI Key: | UOUDEEISQIAYSK-UHFFFAOYSA-N |
LogP: | 1.76760 |
Publication Number | Title | Priority Date |
US-2013345212-A1 | Quinolinone derivatives | 20110307 |
US-2015238480-A1 | Quinolinone derivatives | 20110307 |
US-9061998-B2 | Quinolinone derivatives | 20110307 |
US-9855260-B2 | Quinolinone derivatives | 20110307 |
WO-2012119978-A1 | Quinolinone derivatives | 20110307 |
Complexity: | 184 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 198.06922237 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 198.06922237 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 35.5 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS