Ethyl 2-(3-Cyanophenoxy)acetate - CAS 55197-25-6
Catalog: |
BB028941 |
Product Name: |
Ethyl 2-(3-Cyanophenoxy)acetate |
CAS: |
55197-25-6 |
Synonyms: |
2-(3-cyanophenoxy)acetic acid ethyl ester; ethyl 2-(3-cyanophenoxy)acetate |
IUPAC Name: | ethyl 2-(3-cyanophenoxy)acetate |
Description: | Ethyl 2-(3-Cyanophenoxy)acetate (CAS# 55197-25-6 ) is a useful research chemical. |
Molecular Weight: | 205.21 |
Molecular Formula: | C11H11NO3 |
Canonical SMILES: | CCOC(=O)COC1=CC=CC(=C1)C#N |
InChI: | InChI=1S/C11H11NO3/c1-2-14-11(13)8-15-10-5-3-4-9(6-10)7-12/h3-6H,2,8H2,1H3 |
InChI Key: | ISWSRQNCRDFATO-UHFFFAOYSA-N |
LogP: | 1.50018 |
Publication Number | Title | Priority Date |
WO-2014016789-A1 | Pyrazolo[3,4-d]pyrimidin-4(5h)-one derivatives as pde9 inhibitors | 20120726 |
JP-2013028575-A | Keap1 protein-binding compound, crystal of complex of Keap1 protein-binding compound and Keap1 protein, and method for producing the same | 20110729 |
TW-200819429-A | Heterocyclic amide compounds and use thereof | 20061027 |
AU-2007282465-A1 | Sulfonamide compound or salt thereof | 20060810 |
AU-2007282465-B2 | Sulfonamide compound or salt thereof | 20060810 |
Complexity: | 256 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 205.07389321 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 205.07389321 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 59.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS