Ethyl 1-Benzylimidazole-2-carboxylate - CAS 865998-45-4
Catalog: |
BB037995 |
Product Name: |
Ethyl 1-Benzylimidazole-2-carboxylate |
CAS: |
865998-45-4 |
Synonyms: |
1-(phenylmethyl)-2-imidazolecarboxylic acid ethyl ester; ethyl 1-benzylimidazole-2-carboxylate |
IUPAC Name: | ethyl 1-benzylimidazole-2-carboxylate |
Description: | Ethyl 1-Benzylimidazole-2-carboxylate (CAS# 865998-45-4) is a useful research chemical. |
Molecular Weight: | 230.26 |
Molecular Formula: | C13H14N2O2 |
Canonical SMILES: | CCOC(=O)C1=NC=CN1CC2=CC=CC=C2 |
InChI: | InChI=1S/C13H14N2O2/c1-2-17-13(16)12-14-8-9-15(12)10-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3 |
InChI Key: | IKHCKQVOPBTOEG-UHFFFAOYSA-N |
MDL: | MFCD11857953 |
LogP: | 2.10810 |
Publication Number | Title | Priority Date |
CN-111187218-A | Application of 1-substituted-1H-imidazole-2-carboxylic acid compounds in preparation of metal β -lactamase inhibitor | 20200226 |
CN-111253317-A | 1-substituted-1H-imidazole-2-carboxylic acid compound | 20200226 |
JP-2017066077-A | Method for producing imidazole-2-carboxylic acid ester derivative or salt thereof | 20150930 |
JP-6507976-B2 | Method for producing imidazole-2-carboxylic acid ester derivative or salt thereof | 20150930 |
EP-2755964-B1 | Sulfonic acid salts of heterocyclylamide-substituted imidazoles | 20110914 |
Complexity: | 252 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 230.105527694 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 230.105527694 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 44.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS