Dimethyl 5-bromoisophthalate - CAS 51760-21-5
Catalog: |
BB027574 |
Product Name: |
Dimethyl 5-bromoisophthalate |
CAS: |
51760-21-5 |
Synonyms: |
dimethyl 5-bromobenzene-1,3-dicarboxylate |
IUPAC Name: | dimethyl 5-bromobenzene-1,3-dicarboxylate |
Description: | Dimethyl 5-bromoisophthalate (CAS# 51760-21-5) is a useful research chemical. |
Molecular Weight: | 273.08 |
Molecular Formula: | C10H9BrO4 |
Canonical SMILES: | COC(=O)C1=CC(=CC(=C1)Br)C(=O)OC |
InChI: | InChI=1S/C10H9BrO4/c1-14-9(12)6-3-7(10(13)15-2)5-8(11)4-6/h3-5H,1-2H3 |
InChI Key: | QUJINGKSNJNXEB-UHFFFAOYSA-N |
Boiling Point: | 150 ℃ |
Density: | 1.505 g/cm3 |
MDL: | MFCD00078709 |
LogP: | 2.02230 |
GHS Hazard Statement: | H301 (86.36%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P310, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112300371-A | Polymer based on phenazine tripolymer, preparation method and battery application thereof | 20201028 |
JP-2021155516-A | Thermoplastics and their uses | 20200326 |
WO-2021165195-A1 | Heteroaryl-triazole compounds as pesticides | 20200218 |
KR-20210070227-A | Metal-organic polyhedral including metallocene structure and method for preparing the same | 20191204 |
WO-2021073456-A1 | Macrocyclic and cage-like molecules based on biphenylarene and derivative compounds, synthesis method therefor and use thereof | 20191015 |
Complexity: | 230 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 271.96842 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 271.96842 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 52.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS