Dimethyl (2-Oxo-3-phenoxypropyl)phosphonate - CAS 40665-68-7
Catalog: |
BB024611 |
Product Name: |
Dimethyl (2-Oxo-3-phenoxypropyl)phosphonate |
CAS: |
40665-68-7 |
Synonyms: |
1-dimethoxyphosphoryl-3-phenoxy-2-propanone; 1-dimethoxyphosphoryl-3-phenoxypropan-2-one |
IUPAC Name: | 1-dimethoxyphosphoryl-3-phenoxypropan-2-one |
Description: | Dimethyl (3-phenoxy-2-oxoproyl)phosphonate Travopropst (T715600), a selective FP prostaglandin receptor agonist. Isopropyl ester of (+)-fluprostenol. Antiglaucoma. Used in the synthesis ofnovel prostanoid thromboxane A2 agonists. |
Molecular Weight: | 258.21 |
Molecular Formula: | C11H15O5P |
Canonical SMILES: | COP(=O)(CC(=O)COC1=CC=CC=C1)OC |
InChI: | InChI=1S/C11H15O5P/c1-14-17(13,15-2)9-10(12)8-16-11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3 |
InChI Key: | NQTSTBMCCAVWOS-UHFFFAOYSA-N |
Boiling Point: | 369.8 ℃ at 760 mmHg |
Density: | 1.209 g/cm3 |
MDL: | MFCD00010225 |
LogP: | 2.12040 |
Publication Number | Title | Priority Date |
CA-2944439-A1 | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
EP-3131145-A1 | Polymer electrolyte composition and polymer electrolyte membrane, membrane-electrolyte assembly, and solid polymer fuel cell using same | 20140407 |
EP-3131145-B1 | Polymer electrolyte composition and polymer electrolyte membrane, membrane-electrolyte assembly, and solid polymer fuel cell using same | 20140407 |
US-10103401-B2 | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
US-2017125832-A1 | Polymer electrolyte composition and polymer electrolyte membrane, polymer electrolyte membrane with catalyst layer, membrane electrode assembly, and polymer electrolyte fuel cell each using the same | 20140407 |
PMID | Publication Date | Title | Journal |
22897953 | 20121115 | Layered hydroxide nickel benzoates: hydrothermal synthesis, structure characterization, and exfoliation reaction | Journal of colloid and interface science |
22951990 | 20121107 | Intermolecular electron transfer promoted by directional donor-acceptor attractions in self-assembled diketopyrrolopyrrole-thiophene films | Physical chemistry chemical physics : PCCP |
22743607 | 20121101 | Green synthesis of gold nanoparticles using Trigonella foenum-graecum and its size-dependent catalytic activity | Spectrochimica acta. Part A, Molecular and biomolecular spectroscopy |
22918450 | 20121021 | Diorganotin(IV) 2-pyridyl selenolates: synthesis, structures and their utility as molecular precursors for the preparation of tin selenide nanocrystals and thin films | Dalton transactions (Cambridge, England : 2003) |
22892685 | 20121007 | Novel heterostructured Bi2S3/BiOI photocatalyst: facile preparation, characterization and visible light photocatalytic performance | Dalton transactions (Cambridge, England : 2003) |
Complexity: | 278 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 258.06571057 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 258.06571057 |
Rotatable Bond Count: | 7 |
Topological Polar Surface Area: | 61.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS