Diethyl 1-Methylimidazole-4,5-dicarboxylate - CAS 1210-92-0
Catalog: |
BB005034 |
Product Name: |
Diethyl 1-Methylimidazole-4,5-dicarboxylate |
CAS: |
1210-92-0 |
Synonyms: |
1-methylimidazole-4,5-dicarboxylic acid diethyl ester; diethyl 1-methylimidazole-4,5-dicarboxylate |
IUPAC Name: | diethyl 1-methylimidazole-4,5-dicarboxylate |
Description: | Diethyl 1-Methylimidazole-4,5-dicarboxylate (CAS# 1210-92-0) is a useful research chemical. |
Molecular Weight: | 226.23 |
Molecular Formula: | C10H14N2O4 |
Canonical SMILES: | CCOC(=O)C1=C(N(C=N1)C)C(=O)OCC |
InChI: | InChI=1S/C10H14N2O4/c1-4-15-9(13)7-8(10(14)16-5-2)12(3)6-11-7/h6H,4-5H2,1-3H3 |
InChI Key: | UCXNJCCDGQJSSE-UHFFFAOYSA-N |
LogP: | 0.77350 |
Publication Number | Title | Priority Date |
WO-2021055326-A1 | Azole-fused pyridazin-3(2h)-one derivatives | 20190916 |
US-2010040963-A1 | Color filter and production method thereof, and solid-state image sensor using the same | 20080814 |
US-2008076044-A1 | Compound or its tautomer, metal complex compound, colored photosensitive curing composition, color filter, and production | 20060927 |
US-2010230647-A1 | Compound or its tautomer, metal complex compound, colored photosensitive curing composition, color filter, and production | 20060927 |
US-2012138877-A1 | Compound or its tautomer, metal complex compound, colored photosensitive curing composition, color filter, and production | 20060927 |
Complexity: | 270 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 226.09535693 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 226.09535693 |
Rotatable Bond Count: | 6 |
Topological Polar Surface Area: | 70.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS