Dibenzofuran-3-sulfonyl Chloride - CAS 42138-14-7
Catalog: |
BB025052 |
Product Name: |
Dibenzofuran-3-sulfonyl Chloride |
CAS: |
42138-14-7 |
Synonyms: |
3-dibenzofuransulfonyl chloride; dibenzofuran-3-sulfonyl chloride |
IUPAC Name: | dibenzofuran-3-sulfonyl chloride |
Description: | Dibenzofuran-3-sulfonyl Chloride (CAS# 42138-14-7) is a useful research chemical. |
Molecular Weight: | 266.70 |
Molecular Formula: | C12H7ClO3S |
Canonical SMILES: | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)S(=O)(=O)Cl |
InChI: | InChI=1S/C12H7ClO3S/c13-17(14,15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h1-7H |
InChI Key: | CGJNXSWIIBSXII-UHFFFAOYSA-N |
Boiling Point: | 420.528 °C at 760 mmHg |
Density: | 1.506 g/cm3 |
Appearance: | Yellow crystals |
MDL: | MFCD03425142 |
LogP: | 4.59430 |
Publication Number | Title | Priority Date |
WO-2021202540-A1 | Hsp70 inhibitors and methods of using same | 20200331 |
WO-2021147882-A1 | Dibenzofuran derivative cathepsin k inhibitor, preparation method therefor and medical use thereof | 20200121 |
CA-2685389-A1 | Tricyclic compounds as matrix metalloproteinase inhibitors | 20070504 |
EP-2144893-A2 | Tricyclic compounds as matrix metalloproteinase inhibitors | 20070504 |
JP-2010526106-A | Tricyclic compounds as matrix metalloprotease inhibitors | 20070504 |
Complexity: | 389 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 265.9804429 |
Formal Charge: | 0 |
Heavy Atom Count: | 17 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 265.9804429 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Sulfur Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS