Di-(2-picolyl)amine - CAS 1539-42-0
Catalog: |
BB010953 |
Product Name: |
Di-(2-picolyl)amine |
CAS: |
1539-42-0 |
Synonyms: |
1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
IUPAC Name: | 1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
Description: | Di-(2-picolyl)amine (CAS# 1539-42-0) is a metal chelators and a potential MBL inhibitors. |
Molecular Weight: | 199.25 |
Molecular Formula: | C12H13N3 |
Canonical SMILES: | C1=CC=NC(=C1)CNCC2=CC=CC=N2 |
InChI: | InChI=1S/C12H13N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1-8,13H,9-10H2 |
InChI Key: | KXZQYLBVMZGIKC-UHFFFAOYSA-N |
Boiling Point: | 139-141 ℃1 mmHg (lit.) |
Purity: | 95 % |
Density: | 1.107 g/mL at 25 ℃ (lit.) |
Appearance: | Colorless to yellow liquid |
MDL: | MFCD00129044 |
LogP: | 2.15730 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-113336658-A | Preparation method of fluorescent probe for detecting zinc ions | 20210529 |
CN-113307829-A | Platinum (II) complex with hydroxamic acid derivative as ligand and preparation method and application thereof | 20210508 |
CN-112574246-A | Zn2+Ratiometric fluorescent probes, preparation and use | 20201214 |
CN-112574246-B | Zn2+Ratiometric fluorescent probes, preparation and use | 20201214 |
CN-112481489-A | Synergistic extraction agent and method for selectively extracting cobalt from acidic cobalt-containing solution by using same | 20201109 |
PMID | Publication Date | Title | Journal |
29803612 | 20180625 | Copper-redox cycling by coumarin-di(2-picolyl)amine hybrid molecule leads to ROS-mediated DNA damage and apoptosis: A mechanism for cancer chemoprevention | Chemico-biological interactions |
23094695 | 20121105 | Guanine nucleobase adducts formed by [Pt(di-(2-picolyl)amine)Cl]Cl: evidence that a tridentate ligand with only in-plane bulk can slow guanine base rotation | Inorganic chemistry |
23021342 | 20121101 | Improving the affinity of naphthalene diimide ligand to telomeric DNA by incorporating Zn²⁺ ions into its dipicolylamine groups | Bioorganic & medicinal chemistry |
22989029 | 20121017 | Reversible metal-dependent destabilization and stabilization of a stem-chelate-loop probe binding to an unmodified DNA target | Bioconjugate chemistry |
22534151 | 20120820 | Fluorescent zinc sensor with minimized proton-induced interferences: photophysical mechanism for fluorescence turn-on response and detection of endogenous free zinc ions | Inorganic chemistry |
Complexity: | 154 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 199.110947427 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 199.110947427 |
Rotatable Bond Count: | 4 |
Topological Polar Surface Area: | 37.8 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS