Decyl chloroformate - CAS 55488-51-2
Catalog: |
BB029054 |
Product Name: |
Decyl chloroformate |
CAS: |
55488-51-2 |
Synonyms: |
decyl carbonochloridate |
IUPAC Name: | decyl carbonochloridate |
Description: | Decyl chloroformate (CAS# 55488-51-2) is a useful research chemical. |
Molecular Weight: | 220.74 |
Molecular Formula: | C11H21ClO2 |
Canonical SMILES: | CCCCCCCCCCOC(=O)Cl |
InChI: | InChI=1S/C11H21ClO2/c1-2-3-4-5-6-7-8-9-10-14-11(12)13/h2-10H2,1H3 |
InChI Key: | AZZCHVHSWUYCQA-UHFFFAOYSA-N |
Boiling Point: | 226-227 °C (lit.) |
Density: | 0.956 g/mL at 25°C(lit.) |
MDL: | MFCD00126853 |
LogP: | 4.50250 |
GHS Hazard Statement: | H314 (100%): Causes severe skin burns and eye damage [Danger Skin corrosion/irritation] |
Precautionary Statement: | P260, P264, P280, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-113332305-A | Lipid composition of cytidine compound | 20210603 |
CN-113336816-A | Cytidine compounds and antitumor application thereof | 20210603 |
CN-112618550-A | Antineoplastic uracil compound and lipid composition thereof | 20210115 |
CN-112245391-A | Antitumor lipid composition | 20201023 |
CN-112266400-A | Antitumor compounds | 20201023 |
PMID | Publication Date | Title | Journal |
19422225 | 20090610 | Reactivity of 1-deoxy-D-erythro-hexo-2,3-diulose: a key intermediate in the maillard chemistry of hexoses | Journal of agricultural and food chemistry |
Complexity: | 137 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 220.1230076 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 220.1230076 |
Rotatable Bond Count: | 10 |
Topological Polar Surface Area: | 26.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 5.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS