Cyclopropyl 4-methoxyphenyl ketone - CAS 7152-03-6
Catalog: |
BB034416 |
Product Name: |
Cyclopropyl 4-methoxyphenyl ketone |
CAS: |
7152-03-6 |
Synonyms: |
cyclopropyl-(4-methoxyphenyl)methanone |
IUPAC Name: | cyclopropyl-(4-methoxyphenyl)methanone |
Description: | Cyclopropyl 4-methoxyphenyl ketone (CAS# 7152-03-6) is a useful research chemical. |
Molecular Weight: | 176.21 |
Molecular Formula: | C11H12O2 |
Canonical SMILES: | COC1=CC=C(C=C1)C(=O)C2CC2 |
InChI: | InChI=1S/C11H12O2/c1-13-10-6-4-9(5-7-10)11(12)8-2-3-8/h4-8H,2-3H2,1H3 |
InChI Key: | YKZSVEVTRUSPOQ-UHFFFAOYSA-N |
Boiling Point: | 94-97 ℃ (0.1 mmHg) |
Density: | 1.142 g/cm3 |
Appearance: | Light yellow crystals |
MDL: | MFCD00001296 |
LogP: | 2.28790 |
Publication Number | Title | Priority Date |
US-10174037-B2 | Dihydropyrazolopyrimidinone compounds as PDE2 inhibitors | 20150604 |
US-2018148453-A1 | Dihydropyrazolopyrimidinone compounds as pde2 inhibitors | 20150604 |
AU-2012255690-A1 | Amine derivatives as potassium channel blockers | 20110516 |
AU-2012255690-B2 | Amine derivatives as potassium channel blockers | 20110516 |
EP-2524912-A1 | Amine derivatives | 20110516 |
PMID | Publication Date | Title | Journal |
19531015 | 20090801 | Synthesis and some reactions of dibutyltin (S)- and (R)-camphorsulfonyl hydrides | Combinatorial chemistry & high throughput screening |
16599615 | 20060414 | Oxygen acidity of ring methoxylated 1,1-diarylalkanol radical cations bearing alpha-cyclopropyl groups. The competition between O-neophyl shift and C-cyclopropyl beta-scission in the intermediate 1,1-diarylalkoxyl radicals | The Journal of organic chemistry |
15115392 | 20040506 | Non-peptidic small-molecule inhibitors of the single-chain hepatitis C virus NS3 protease/NS4A cofactor complex discovered by structure-based NMR screening | Journal of medicinal chemistry |
Complexity: | 188 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 176.083729621 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 176.083729621 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 26.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS