Cyclohexylacetyl chloride - CAS 23860-35-7
Catalog: |
BB018210 |
Product Name: |
Cyclohexylacetyl chloride |
CAS: |
23860-35-7 |
Synonyms: |
2-cyclohexylacetyl chloride |
IUPAC Name: | 2-cyclohexylacetyl chloride |
Description: | Cyclohexylacetyl chloride (CAS# 23860-35-7) is a useful research chemical. |
Molecular Weight: | 160.64 |
Molecular Formula: | C8H13ClO |
Canonical SMILES: | C1CCC(CC1)CC(=O)Cl |
InChI: | InChI=1S/C8H13ClO/c9-8(10)6-7-4-2-1-3-5-7/h7H,1-6H2 |
InChI Key: | VABYVFZVTIDNOA-UHFFFAOYSA-N |
Boiling Point: | 187 °C (lit.) |
Density: | 1.047 g/mL at 25°C(lit.) |
Appearance: | Liquid |
MDL: | MFCD03424702 |
LogP: | 2.72220 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P260, P264, P270, P280, P301+P312, P301+P330+P331, P303+P361+P353, P304+P340, P305+P351+P338, P310, P321, P330, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-112341320-A | Novel synthesis method of p- (trans-4-hydroxycyclohexyl) phenol | 20201102 |
US-2021292348-A1 | Antiviral compounds | 20200218 |
WO-2021168004-A1 | Antiviral compounds | 20200218 |
CN-113121609-A | Metal complex, electroluminescent device comprising metal complex and application of electroluminescent device | 20200116 |
KR-20210093180-A | Metal complex, electroluminescent device including the same, and use thereof | 20200116 |
Complexity: | 116 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.0654927 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.0654927 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 17.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS