cyclohexyl-pyridin-4-ylmethyl-amine - CAS 128802-98-2
Catalog: |
BB006937 |
Product Name: |
cyclohexyl-pyridin-4-ylmethyl-amine |
CAS: |
128802-98-2 |
Synonyms: |
N-(pyridin-4-ylmethyl)cyclohexanamine; N-(pyridin-4-ylmethyl)cyclohexanamine |
IUPAC Name: | N-(pyridin-4-ylmethyl)cyclohexanamine |
Description: | cyclohexyl-pyridin-4-ylmethyl-amine (CAS# 128802-98-2) is a useful research chemical. |
Molecular Weight: | 190.28 |
Molecular Formula: | C12H18N2 |
Canonical SMILES: | C1CCC(CC1)NCC2=CC=NC=C2 |
InChI: | InChI=1S/C12H18N2/c1-2-4-12(5-3-1)14-10-11-6-8-13-9-7-11/h6-9,12,14H,1-5,10H2 |
InChI Key: | LSAPGRIUVWGKBN-UHFFFAOYSA-N |
Boiling Point: | 314.9 °C at 760 mmHg |
Purity: | 95 % |
Storage: | Sealed in dry, 2-8 °C |
MDL: | MFCD00980823 |
LogP: | 2.89480 |
Publication Number | Title | Priority Date |
EP-1765791-A1 | Pyrimidine derivatives useful as inhibitors of pkc-theta | 20040708 |
WO-2006014482-A1 | Pyrimidine derivatives useful as inhibitors of pkc-theta | 20040708 |
AU-3675900-A | Nitrogen-containing heterocyclic compounds and benamide compounds and drugs containing the same | 19990409 |
AU-779550-B2 | Nitrogen-containing heterocyclic compounds and benamide compounds and drugs containing the same | 19990409 |
CA-2369103-A1 | Nitrogen-containing heterocyclic compounds and benamide compounds and drugs containing the same | 19990409 |
Complexity: | 146 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 190.146998583 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 190.146998583 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 24.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS