cis-3,5-Dimethyldihydro-2H-pyran-2,6(3H)-dione - CAS 4295-92-5
Catalog: |
BB025291 |
Product Name: |
cis-3,5-Dimethyldihydro-2H-pyran-2,6(3H)-dione |
CAS: |
4295-92-5 |
Synonyms: |
(3R,5S)-3,5-dimethyloxane-2,6-dione; (3R,5S)-3,5-dimethyloxane-2,6-dione |
IUPAC Name: | (3S,5R)-3,5-dimethyloxane-2,6-dione |
Description: | cis-3,5-Dimethyldihydro-2H-pyran-2,6(3H)-dione (CAS# 4295-92-5) is a useful research chemical compound. |
Molecular Weight: | 142.15 |
Molecular Formula: | C7H10O3 |
Canonical SMILES: | CC1CC(C(=O)OC1=O)C |
InChI: | InChI=1S/C7H10O3/c1-4-3-5(2)7(9)10-6(4)8/h4-5H,3H2,1-2H3/t4-,5+ |
InChI Key: | SIFQWEJOHACJOL-SYDPRGILSA-N |
MDL: | MFCD09152749 |
LogP: | 0.73210 |
Publication Number | Title | Priority Date |
WO-2019183577-A1 | Modulators of g-protein coupled receptors | 20180323 |
AU-2019237507-A1 | Modulators of G-protein coupled receptors | 20180323 |
BR-112020019148-A2 | receptor modulators coupled to g protein | 20180323 |
CN-112236161-A | Modulators of G protein-coupled receptors | 20180323 |
EP-3768294-A1 | Modulators of g-protein coupled receptors | 20180323 |
PMID | Publication Date | Title | Journal |
16524259 | 20060316 | Chemoenzymatic synthesis of the C10-C23 segment of dictyostatin | Organic letters |
Complexity: | 156 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 142.062994177 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 142.062994177 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 43.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS