cis-1-Boc-4-Cbz-2,6-dimethylpiperazine - CAS 2080367-38-8
Catalog: |
BB016311 |
Product Name: |
cis-1-Boc-4-Cbz-2,6-dimethylpiperazine |
CAS: |
2080367-38-8 |
Synonyms: |
(2S,6R)-2,6-dimethylpiperazine-1,4-dicarboxylic acid O1-tert-butyl ester O4-(phenylmethyl) ester; 4-O-benzyl 1-O-tert-butyl (2S,6R)-2,6-dimethylpiperazine-1,4-dicarboxylate |
IUPAC Name: | 4-O-benzyl 1-O-tert-butyl (2S,6R)-2,6-dimethylpiperazine-1,4-dicarboxylate |
Description: | cis-1-Boc-4-Cbz-2,6-dimethylpiperazine (CAS# 2080367-38-8 ) is a useful research chemical. |
Molecular Weight: | 348.44 |
Molecular Formula: | C19H28N2O4 |
Canonical SMILES: | CC1CN(CC(N1C(=O)OC(C)(C)C)C)C(=O)OCC2=CC=CC=C2 |
InChI: | InChI=1S/C19H28N2O4/c1-14-11-20(17(22)24-13-16-9-7-6-8-10-16)12-15(2)21(14)18(23)25-19(3,4)5/h6-10,14-15H,11-13H2,1-5H3/t14-,15+ |
InChI Key: | BQDWTKGOXJXCIY-GASCZTMLSA-N |
Publication Number | Title | Priority Date |
AU-2016303891-A1 | 1,3,4-oxadiazole derivative compounds as histone deacetylase 6 inhibitor, and the pharmaceutical composition comprising the same | 20150804 |
JP-2018523663-A | 1,3,4-oxadiazole derivative compound as histone deacetylase 6 inhibitor and pharmaceutical composition containing the same | 20150804 |
JP-6491393-B2 | 1,3,4-Oxadiazole derivative compounds as histone deacetylase 6 inhibitors and pharmaceutical compositions containing the same | 20150804 |
KR-101799010-B1 | 1,3,4-Oxadiazole Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20150804 |
KR-20170017792-A | 1,3,4-Oxadiazole Derivative Compounds as Histone Deacetylase 6 Inhibitor, and the Pharmaceutical Composition Comprising the same | 20150804 |
Complexity: | 457 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 348.20490738 |
Formal Charge: | 0 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 4 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 348.20490738 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 59.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperazines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS