cis-1-Boc-2,6-dimethylpiperazine - CAS 180975-66-0
Catalog: |
BB013777 |
Product Name: |
cis-1-Boc-2,6-dimethylpiperazine |
CAS: |
180975-66-0 |
Synonyms: |
(2S,6R)-2,6-dimethyl-1-piperazinecarboxylic acid tert-butyl ester; tert-butyl (2S,6R)-2,6-dimethylpiperazine-1-carboxylate |
IUPAC Name: | tert-butyl (2S,6R)-2,6-dimethylpiperazine-1-carboxylate |
Description: | cis-1-Boc-2,6-dimethylpiperazine (CAS# 180975-66-0) is a useful research chemical compound. |
Molecular Weight: | 214.30 |
Molecular Formula: | C11H22N2O2 |
Canonical SMILES: | CC1CNCC(N1C(=O)OC(C)(C)C)C |
InChI: | InChI=1S/C11H22N2O2/c1-8-6-12-7-9(2)13(8)10(14)15-11(3,4)5/h8-9,12H,6-7H2,1-5H3/t8-,9+ |
InChI Key: | RBOGBIZGALIITO-DTORHVGOSA-N |
Boiling Point: | 279.7 °C at 760 mmHg |
Density: | 0.97 g/cm3 |
MDL: | MFCD09265026 |
LogP: | 1.87040 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112574199-A | Heterocyclic compounds as Kras-G12C inhibitors | 20200520 |
CN-112574199-B | Heterocyclic compounds as Kras-G12C inhibitors | 20200520 |
US-2021315896-A1 | Indazole based compounds and associated methods of use | 20200321 |
WO-2021194879-A1 | Indazole based compounds and associated methods of use | 20200321 |
WO-2021127404-A1 | Tricyclic pyridones and pyrimidones | 20191220 |
Complexity: | 225 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 2 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 214.168127949 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 214.168127949 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 41.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Piperazines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS