Bis[(2-diphenylphosphino)ethyl]ammonium chloride - CAS 66534-97-2
Catalog: |
BB033057 |
Product Name: |
Bis[(2-diphenylphosphino)ethyl]ammonium chloride |
CAS: |
66534-97-2 |
Synonyms: |
2-diphenylphosphanyl-N-(2-diphenylphosphanylethyl)ethanamine;hydrochloride |
IUPAC Name: | 2-diphenylphosphanyl-N-(2-diphenylphosphanylethyl)ethanamine;hydrochloride |
Description: | Bis[(2-diphenylphosphino)ethyl]ammonium chloride (CAS# 66534-97-2) is used in preparation of Tetradentate Diaminodiphosphine ligands and transition metal complexes as hydrogenation or dehydrogenation catalysts. |
Molecular Weight: | 477.95 |
Molecular Formula: | C28H30ClNP2 |
Canonical SMILES: | C1=CC=C(C=C1)P(CCNCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl |
InChI: | InChI=1S/C28H29NP2.ClH/c1-5-13-25(14-6-1)30(26-15-7-2-8-16-26)23-21-29-22-24-31(27-17-9-3-10-18-27)28-19-11-4-12-20-28;/h1-20,29H,21-24H2;1H |
InChI Key: | AVDUVHMGGDOIQI-UHFFFAOYSA-N |
Boiling Point: | 566.7 °C at 760 mmHg |
LogP: | 6.03470 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation]; H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation]; H335 (100%): May cause respiratory irritation [Warning Specific target organ toxicity, single exposure; Respiratory tract irritation] |
Precautionary Statement: | P261, P264, P264+P265, P271, P280, P302+P352, P304+P340, P305+P351+P338, P319, P321, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-110746597-A | Ruthenium-based catalyst Ru-PPh2CO, preparation method and application | 20191018 |
CA-3000609-A1 | Method for producing ruthenium complex | 20150930 |
EP-3357930-A1 | Method for producing ruthenium complex | 20150930 |
EP-3357930-B1 | Method for producing ruthenium complex | 20150930 |
JP-WO2017056916-A1 | Method for producing ruthenium complex | 20150930 |
PMID | Publication Date | Title | Journal |
15962985 | 20050627 | New approach to the chemistry of technetium(V) and rhenium(V) phenylimido complexes: novel [M(NPh)PNP]3+ metal fragments (M = Tc, Re; PNP = aminodiphosphine) suitable for the synthesis of stable mixed-ligand compounds | Inorganic chemistry |
Complexity: | 382 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 2 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 477.1542017 |
Formal Charge: | 0 |
Heavy Atom Count: | 32 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 477.1542017 |
Rotatable Bond Count: | 10 |
Topological Polar Surface Area: | 12 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS