Biphenylene - CAS 259-79-0
Catalog: |
BB019090 |
Product Name: |
Biphenylene |
CAS: |
259-79-0 |
Synonyms: |
biphenylene |
IUPAC Name: | biphenylene |
Description: | Biphenylene (CAS# 259-79-0) is a useful research chemical compound. |
Molecular Weight: | 152.19 |
Molecular Formula: | C12H8 |
Canonical SMILES: | C1=CC2=C3C=CC=CC3=C2C=C1 |
InChI: | InChI=1S/C12H8/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h1-8H |
InChI Key: | IFVTZJHWGZSXFD-UHFFFAOYSA-N |
Boiling Point: | 262.4 °C at 760 mmHg |
Density: | 1.19 g/cm3 |
Appearance: | Yellow needles |
MDL: | MFCD00001110 |
LogP: | 3.33400 |
Publication Number | Title | Priority Date |
CN-113480578-A | (alpha-diimine) nickel complex compositions and uses thereof | 20210623 |
CN-113121584-A | Heterocyclic compound and organic electroluminescent device comprising same | 20210330 |
CN-112467056-A | Green light OLED device with waveguide mode light coupling enhancement and preparation method thereof | 20201223 |
KR-102297539-B1 | Polyurethane tougheners for epoxy adhesives | 20200825 |
CN-111607153-A | High-wear-resistance material of organic polymer modified crosslinked polyethylene and preparation method thereof | 20200630 |
PMID | Publication Date | Title | Journal |
23043331 | 20121017 | Oxidative addition of carbon-carbon bonds with a redox-active bis(imino)pyridine iron complex | Journal of the American Chemical Society |
22676474 | 20120821 | The 'Texas-sized' molecular box: a versatile building block for the construction of anion-directed mechanically interlocked structures | Accounts of chemical research |
22524304 | 20120507 | Photoinduced electron transfer in Os(terpyridine)-biphenylene-(bi)pyridinium assemblies | Inorganic chemistry |
22407483 | 20120402 | Synthesis of aromatic compounds by catalytic C-C bond activation of biphenylene or angular [3]phenylene | Chemistry (Weinheim an der Bergstrasse, Germany) |
22291013 | 20120316 | NOX5 in human spermatozoa: expression, function, and regulation | The Journal of biological chemistry |
Complexity: | 133 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 152.062600255 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 0 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 152.062600255 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 0 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Arenes
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS