benzyl 3-formylcyclobutane-1-carboxylate - CAS 1613330-47-4
Catalog: |
BB011727 |
Product Name: |
benzyl 3-formylcyclobutane-1-carboxylate |
CAS: |
1613330-47-4 |
Synonyms: |
3-formyl-1-cyclobutanecarboxylic acid (phenylmethyl) ester; benzyl 3-formylcyclobutane-1-carboxylate |
IUPAC Name: | benzyl 3-formylcyclobutane-1-carboxylate |
Description: | benzyl 3-formylcyclobutane-1-carboxylate (CAS# 1613330-47-4 ) is a useful research chemical. |
Molecular Weight: | 218.252 |
Molecular Formula: | C13H14O3 |
Canonical SMILES: | C1C(CC1C(=O)OCC2=CC=CC=C2)C=O |
InChI: | InChI=1S/C13H14O3/c14-8-11-6-12(7-11)13(15)16-9-10-4-2-1-3-5-10/h1-5,8,11-12H,6-7,9H2 |
InChI Key: | BZWIIRGKMBSAEO-UHFFFAOYSA-N |
Publication Number | Title | Priority Date |
WO-2021067606-A1 | Brm targeting compounds and associated methods of use | 20191001 |
US-2019300521-A1 | Brm targeting compounds and associated methods of use | 20180401 |
US-2020038378-A1 | Brm targeting compounds and associated methods of use | 20180401 |
WO-2019195201-A1 | Brm targeting compounds and associated methods of use | 20180401 |
AU-2017359025-A1 | Cyclobutane- and azetidine-containing mono and spirocyclic compounds as alpha V integrin inhibitors | 20161108 |
Complexity: | 250 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 218.094294304 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 218.094294304 |
Rotatable Bond Count: | 5 |
Topological Polar Surface Area: | 43.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Cyclobutane
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS