Benzothiazole-2-carbonyl chloride - CAS 67748-61-2
Catalog: |
BB033387 |
Product Name: |
Benzothiazole-2-carbonyl chloride |
CAS: |
67748-61-2 |
Synonyms: |
1,3-benzothiazole-2-carbonyl chloride |
IUPAC Name: | 1,3-benzothiazole-2-carbonyl chloride |
Description: | Benzothiazole-2-carbonyl chloride (CAS# 67748-61-2) is a useful research chemical. |
Molecular Weight: | 197.64 |
Molecular Formula: | C8H4ClNOS |
Canonical SMILES: | C1=CC=C2C(=C1)N=C(S2)C(=O)Cl |
InChI: | InChI=1S/C8H4ClNOS/c9-7(11)8-10-5-3-1-2-4-6(5)12-8/h1-4H |
InChI Key: | AOIGQLLPWDXVGB-UHFFFAOYSA-N |
Boiling Point: | 328.4 °C at 760 mmHg |
Melting Point: | 150 °C (dec.) |
Purity: | 95 % |
Density: | 1.489 g/cm3 |
MDL: | MFCD03659697 |
LogP: | 2.67530 |
GHS Hazard Statement: | H312 (90.7%): Harmful in contact with skin [Warning Acute toxicity, dermal] |
Precautionary Statement: | P260, P261, P264, P271, P280, P301+P330+P331, P302+P352, P303+P361+P353, P304+P312, P304+P340, P305+P351+P338, P310, P312, P321, P322, P337+P313, P363, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
KR-20210036016-A | Block copolymer, preparing method thereof and asphalt composition comprising the same | 20190925 |
CN-109608415-B | Thiazole methanamide compound and synthesis and application thereof | 20190121 |
AU-2013225838-A1 | Heterobicyclic compounds and their use as phosphodiesterase inhibitors | 20120229 |
CA-2865980-A1 | Heterobicyclic compounds | 20120229 |
EP-2820014-A1 | Heterobicyclic compounds and their use as phosphodiesterase inhibitors | 20120229 |
Complexity: | 200 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 196.9702126 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 196.9702126 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 58.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Oxazole/Thiazole
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS