alpha-(1-Naphthyl)benzylamine - CAS 2936-63-2
Catalog: |
BB020174 |
Product Name: |
alpha-(1-Naphthyl)benzylamine |
CAS: |
2936-63-2 |
Synonyms: |
1-naphthalenyl(phenyl)methanamine; naphthalen-1-yl(phenyl)methanamine |
IUPAC Name: | naphthalen-1-yl(phenyl)methanamine |
Description: | alpha-(1-Naphthyl)benzylamine (CAS# 2936-63-2) is a useful research chemical. |
Molecular Weight: | 233.31 |
Molecular Formula: | C17H15N |
Canonical SMILES: | C1=CC=C(C=C1)C(C2=CC=CC3=CC=CC=C32)N |
InChI: | InChI=1S/C17H15N/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16/h1-12,17H,18H2 |
InChI Key: | MKYLPACDIKGXSW-UHFFFAOYSA-N |
LogP: | 4.58820 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
US-2020199481-A1 | Grease compositions having calcium sulfonate and polyurea thickeners | 20181219 |
WO-2020131440-A1 | Grease compositions having calcium sulfonate and polyurea thickeners | 20181219 |
WO-2015156421-A1 | Dihydrothiazine and dihydrooxazine derivatives having bace1 inhibitory activity | 20140411 |
EP-2952503-A1 | Hiv replication inhibitor | 20130131 |
EP-2297117-B1 | Bicyclic heterocycle derivatives and use thereof as gpr119 modulators | 20080519 |
Complexity: | 256 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 233.120449483 |
Formal Charge: | 0 |
Heavy Atom Count: | 18 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 233.120449483 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 26 Å2 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS