Allyl carbamate - CAS 2114-11-6
Catalog: |
BB016646 |
Product Name: |
Allyl carbamate |
CAS: |
2114-11-6 |
Synonyms: |
prop-2-enyl carbamate |
IUPAC Name: | prop-2-enyl carbamate |
Description: | Allyl carbamate (CAS# 2114-11-6 ) is a useful research chemical. |
Molecular Weight: | 101.10 |
Molecular Formula: | C4H7NO2 |
Canonical SMILES: | C=CCOC(=O)N |
InChI: | InChI=1S/C4H7NO2/c1-2-3-7-4(5)6/h2H,1,3H2,(H2,5,6) |
InChI Key: | OCAAZRFBJBEVPS-UHFFFAOYSA-N |
Boiling Point: | 208 °C at 760 mmHg |
Density: | 1.044 g/cm3 |
Appearance: | Liquid |
MDL: | MFCD00025468 |
LogP: | 0.96800 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P273, P280, P301+P312, P305+P351+P338, P330, P337+P313, P391, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111778714-A | Preparation process of high-performance fiber three-phase composite material | 20200608 |
US-2021317244-A1 | Silicone hydrogel materials | 20200410 |
WO-2021203055-A1 | Viral entry inhibitors and rna polymerase inhibitors | 20200403 |
WO-2021202694-A1 | Phenolic acid lipid based cationic lipids | 20200401 |
WO-2021195401-A1 | Technologies for preventing or treating infections | 20200325 |
PMID | Publication Date | Title | Journal |
22653159 | 20120531 | Synthesis of polystyrene microspheres and functionalization with Pd(0) nanoparticles to perform bioorthogonal organometallic chemistry in living cells | Nature protocols |
21336331 | 20110301 | Palladium-mediated intracellular chemistry | Nature chemistry |
20098608 | 20091127 | A submarine journey: the pyrrole-imidazole alkaloids | Marine drugs |
16856188 | 20060825 | Ruthenium-induced allylcarbamate cleavage in living cells | Angewandte Chemie (International ed. in English) |
15914913 | 20050501 | Allyl cyanate-to-isocyanate rearrangement for the synthesis of quaternary stereocenter with nitrogen substituent | Bioscience, biotechnology, and biochemistry |
Complexity: | 79.8 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 101.047678466 |
Formal Charge: | 0 |
Heavy Atom Count: | 7 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 101.047678466 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 52.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS