9-(Diethylamino)-3-hydroxy-5H-benzo[a]phenoxazin-5-one - CAS 93397-90-1
Catalog: |
BB040901 |
Product Name: |
9-(Diethylamino)-3-hydroxy-5H-benzo[a]phenoxazin-5-one |
CAS: |
93397-90-1 |
Synonyms: |
9-(diethylamino)-3-hydroxy-5-benzo[a]phenoxazinone; 9-(diethylamino)-3-hydroxybenzo[a]phenoxazin-5-one |
IUPAC Name: | 9-(diethylamino)-3-hydroxybenzo[a]phenoxazin-5-one |
Description: | 9-(Diethylamino)-3-hydroxy-5H-benzo[a]phenoxazin-5-one (CAS# 93397-90-1 ) is a useful research chemical. |
Molecular Weight: | 334.37 |
Molecular Formula: | C20H18N2O3 |
Canonical SMILES: | CCN(CC)C1=CC2=C(C=C1)N=C3C4=C(C=C(C=C4)O)C(=O)C=C3O2 |
InChI: | InChI=1S/C20H18N2O3/c1-3-22(4-2)12-5-8-16-18(9-12)25-19-11-17(24)15-10-13(23)6-7-14(15)20(19)21-16/h5-11,23H,3-4H2,1-2H3 |
InChI Key: | YJCSMRAXCRGQSQ-UHFFFAOYSA-N |
LogP: | 3.58550 |
Publication Number | Title | Priority Date |
US-2021115000-A1 | Nile red derivatives for improved ratiometric imaging for nerve specific contrast | 20180426 |
EP-2695930-A1 | Polymerizable liquid crystal composition, polarized light-emitting coating material, novel naphtholactam derivative, novel coumarin derivative, novel nile red derivative, and novel anthracene derivative | 20110330 |
EP-2695930-B1 | Polymerizable liquid crystal composition, polarized light-emitting coating material, novel naphtholactam derivative, novel coumarin derivative, novel nile red derivative, and novel anthracene derivative | 20110330 |
US-2013334461-A1 | Polymerizable liquid crystal composition, polarized light-emitting coating material, novel naphtholactam derivative novel coumarin derivative, novel nile red derivative, and novel anthracene derivative | 20110330 |
US-9475991-B2 | Polymerizable liquid crystal composition, polarized light-emitting coating material, novel naphtholactam derivative novel coumarin derivative, novel nile red derivative, and novel anthracene derivative | 20110330 |
Complexity: | 596 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 334.13174244 |
Formal Charge: | 0 |
Heavy Atom Count: | 25 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 334.13174244 |
Rotatable Bond Count: | 3 |
Topological Polar Surface Area: | 62.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS