8-Methyl-quinoline-3-carboxylic acid - CAS 71082-55-8
Catalog: |
BB034305 |
Product Name: |
8-Methyl-quinoline-3-carboxylic acid |
CAS: |
71082-55-8 |
Synonyms: |
8-methylquinoline-3-carboxylic acid |
IUPAC Name: | 8-methylquinoline-3-carboxylic acid |
Description: | 8-Methyl-quinoline-3-carboxylic acid (CAS# 71082-55-8) is a useful research chemical. |
Molecular Weight: | 187.19 |
Molecular Formula: | C11H9NO2 |
Canonical SMILES: | CC1=CC=CC2=CC(=CN=C12)C(=O)O |
InChI: | InChI=1S/C11H9NO2/c1-7-3-2-4-8-5-9(11(13)14)6-12-10(7)8/h2-6H,1H3,(H,13,14) |
InChI Key: | IKQVXJGBIGBKNW-UHFFFAOYSA-N |
Boiling Point: | 361.8 °C at 760 mmHg |
Density: | 1.285 g/cm3 |
Appearance: | Solid |
LogP: | 2.24140 |
GHS Hazard Statement: | H319 (100%): Causes serious eye irritation [Warning Serious eye damage/eye irritation] |
Precautionary Statement: | P264+P265, P280, P305+P351+P338, and P337+P317 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
AU-676729-B2 | 5-amino-8-methyl-7-pyrrolidinylquinoline-3-carboxylic acid derivative | 19930827 |
CA-2126118-C | 5-amino-8-methyl-7-pyrrolidinylquinoline-3-carboxylic acid derivative | 19930827 |
CZ-157494-A3 | Derivative of 5-amino-8-methyl-7-pyrrolidinylquinoline-3-carboxylic acid, stereoisomer and salt thereof, process for preparing said derivative and pharmaceutical composition containing thereof | 19930827 |
CZ-286524-B6 | 5-Amino-8-methyl-7-pyrrolidinylquinoline-3-carboxylic acid derivative, stereoisomer and salt thereof, method of preparation and pharmaceutical composition containing it | 19930827 |
EP-0641793-A1 | 5-Amino-8-methyl-7-pyrrolidinylquinoline-3-carboxylic acid derivative | 19930827 |
Complexity: | 229 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 187.06332853 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 187.06332853 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 50.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS