8-Fluoro-3-iodoquinoline - CAS 866782-59-4
Catalog: |
BB038026 |
Product Name: |
8-Fluoro-3-iodoquinoline |
CAS: |
866782-59-4 |
Synonyms: |
8-fluoro-3-iodoquinoline; 8-fluoro-3-iodoquinoline |
IUPAC Name: | 8-fluoro-3-iodoquinoline |
Description: | 8-Fluoro-3-iodoquinoline (CAS# 866782-59-4) is a useful research chemical. |
Molecular Weight: | 273.05 |
Molecular Formula: | C9H5FIN |
Canonical SMILES: | C1=CC2=CC(=CN=C2C(=C1)F)I |
InChI: | InChI=1S/C9H5FIN/c10-8-3-1-2-6-4-7(11)5-12-9(6)8/h1-5H |
InChI Key: | PFDRCQPNBZLTJQ-UHFFFAOYSA-N |
Boiling Point: | 324.4 °C at 760 mmHg |
Density: | 1.908 g/cm3 |
LogP: | 2.97850 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
TW-201930316-A | Heterocyclic benzene sulfonamide and the like | 20171222 |
WO-2019122320-A1 | Heterocyclic benzosultams and analogues | 20171222 |
AU-2017291886-A1 | Benzosultams and analogues and their use as fungicides | 20160704 |
CA-3029780-A1 | Benzosultams and analogues and their use as fungicides | 20160704 |
EP-3478659-A1 | Benzosultams and analogues and their use as fungicides | 20160704 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 272.94507 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 272.94507 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS