8-Chloro-3-iodoquinoline - CAS 847727-21-3
Catalog: |
BB037297 |
Product Name: |
8-Chloro-3-iodoquinoline |
CAS: |
847727-21-3 |
Synonyms: |
8-chloro-3-iodoquinoline; 8-chloro-3-iodoquinoline |
IUPAC Name: | 8-chloro-3-iodoquinoline |
Description: | 8-Chloro-3-iodoquinoline (CAS# 847727-21-3) is a useful research chemical. |
Molecular Weight: | 289.50 |
Molecular Formula: | C9H5ClIN |
Canonical SMILES: | C1=CC2=CC(=CN=C2C(=C1)Cl)I |
InChI: | InChI=1S/C9H5ClIN/c10-8-3-1-2-6-4-7(11)5-12-9(6)8/h1-5H |
InChI Key: | CLABEFPWOLGBAP-UHFFFAOYSA-N |
LogP: | 3.49280 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P312, P322, P330, P363, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111072555-A | Method for preparing heterocyclic sulfone organic compound | 20200116 |
CN-111072555-B | Method for preparing heterocyclic sulfone organic compound | 20200116 |
US-2013157996-A1 | Trpm8 antagonists and their use in treatments | 20110624 |
US-2013158034-A1 | Trpm8 antagonists and their use in treatments | 20110624 |
US-2014171406-A1 | Trpm8 antagonists and their use in treatments | 20110624 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 288.91552 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 288.91552 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS