8-Bromo-5-nitroquinoline - CAS 139366-35-1
Catalog: |
BB008930 |
Product Name: |
8-Bromo-5-nitroquinoline |
CAS: |
139366-35-1 |
Synonyms: |
8-bromo-5-nitroquinoline; 8-bromo-5-nitroquinoline |
IUPAC Name: | 8-bromo-5-nitroquinoline |
Description: | 8-Bromo-5-nitroquinoline (CAS# 139366-35-1) is a useful research chemical. |
Molecular Weight: | 253.05 |
Molecular Formula: | C9H5BrN2O2 |
Canonical SMILES: | C1=CC2=C(C=CC(=C2N=C1)Br)[N+](=O)[O-] |
InChI: | InChI=1S/C9H5BrN2O2/c10-7-3-4-8(12(13)14)6-2-1-5-11-9(6)7/h1-5H |
InChI Key: | LEMUPVPKQOTZAE-UHFFFAOYSA-N |
LogP: | 3.42870 |
Publication Number | Title | Priority Date |
CN-112390751-A | Toll-like receptor-7 small molecule inhibitor and preparation method thereof | 20201105 |
AU-2002361785-B2 | Fused heterocyclic succinimidecompounds and analogs thereof, modulators of nuclear hormone receptor function | 20011219 |
CA-2471342-A1 | Fused heterocyclic succinimide compounds and analogs thereof, modulators of nuclear hormone receptor function | 20011219 |
CN-1589271-A | Fused heterocyclic succinimide compounds and analogs thereof as modulators of nuclear hormone receptor function | 20011219 |
EP-1458723-A1 | Fused heterocyclic succinimidecompounds and analogs thereof, modulators of nuclear hormone receptor function | 20011219 |
Complexity: | 231 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 251.95344 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 251.95344 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 58.7 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS