7-(Trifluoromethoxy)isatin - CAS 149125-30-4
Catalog: |
BB010377 |
Product Name: |
7-(Trifluoromethoxy)isatin |
CAS: |
149125-30-4 |
Synonyms: |
7-(trifluoromethoxy)-1H-indole-2,3-dione; 7-(trifluoromethoxy)-1H-indole-2,3-dione |
IUPAC Name: | 7-(trifluoromethoxy)-1H-indole-2,3-dione |
Description: | 7-(Trifluoromethoxy)isatin (CAS# 149125-30-4) is a useful research chemical. |
Molecular Weight: | 231.13 |
Molecular Formula: | C9H4F3NO3 |
Canonical SMILES: | C1=CC2=C(C(=C1)OC(F)(F)F)NC(=O)C2=O |
InChI: | InChI=1S/C9H4F3NO3/c10-9(11,12)16-5-3-1-2-4-6(5)13-8(15)7(4)14/h1-3H,(H,13,14,15) |
InChI Key: | JDVUYYNGNVYMKQ-UHFFFAOYSA-N |
Density: | 1.562 g/cm3 |
MDL: | MFCD06804535 |
LogP: | 1.85800 |
Publication Number | Title | Priority Date |
CA-2984305-A1 | Indolone compounds and their use as ampa receptor modulators | 20150429 |
EP-3288935-A1 | Indolone compounds and their use as ampa receptor modulators | 20150429 |
EP-3288935-B1 | Indolone compounds and their use as ampa receptor modulators | 20150429 |
JP-2018514543-A | Indrone compounds and their use as AMPA receptor modulators | 20150429 |
KR-20170141769-A | Indolone compounds and their use as AMPA receptor modulators | 20150429 |
Complexity: | 329 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 231.01432748 |
Formal Charge: | 0 |
Heavy Atom Count: | 16 |
Hydrogen Bond Acceptor Count: | 6 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 231.01432748 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 55.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS