7-Quinazolinamine - CAS 101421-73-2
Catalog: |
BB000507 |
Product Name: |
7-Quinazolinamine |
CAS: |
101421-73-2 |
Synonyms: |
7-quinazolinamine; quinazolin-7-amine |
IUPAC Name: | quinazolin-7-amine |
Description: | 7-Quinazolinamine (CAS# 101421-73-2) is a useful research chemical. |
Molecular Weight: | 145.16 |
Molecular Formula: | C8H7N3 |
Canonical SMILES: | C1=CC2=CN=CN=C2C=C1N |
InChI: | InChI=1S/C8H7N3/c9-7-2-1-6-4-10-5-11-8(6)3-7/h1-5H,9H2 |
InChI Key: | JBFKTGKPNDZSPY-UHFFFAOYSA-N |
Boiling Point: | 335.935 °C at 760 mmHg |
Density: | 1.293 g/cm3 |
MDL: | MFCD10697884 |
LogP: | 1.79320 |
Publication Number | Title | Priority Date |
CN-112538072-A | Novel aminopyrimidine EGFR (epidermal growth factor receptor) inhibitor | 20190921 |
WO-2020177629-A1 | Spiro-substituted pyrimidine-fused cyclic compound, preparation method therefor and medical use thereof | 20190301 |
TW-201945355-A | Condensed cyclic urea derivatives as CRHR2 antagonists | 20180409 |
WO-2019198692-A1 | Fused cyclic urea derivatives as crhr2 antagonist | 20180409 |
CN-111868037-A | Fused cyclic urea derivatives as CRHR2 antagonists | 20180409 |
PMID | Publication Date | Title | Journal |
22326394 | 20120301 | Design and synthesis of novel 7-aminoquinazoline derivatives: antitumor and anticonvulsant activities | Bioorganic & medicinal chemistry letters |
Complexity: | 137 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 145.063997236 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 145.063997236 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 51.8 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinazolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS