7-Iodofuro[3,2-c]pyridine-2-carbaldehyde - CAS 342601-33-6
Catalog: |
BB022032 |
Product Name: |
7-Iodofuro[3,2-c]pyridine-2-carbaldehyde |
CAS: |
342601-33-6 |
Synonyms: |
7-iodo-2-furo[3,2-c]pyridinecarboxaldehyde; 7-iodofuro[3,2-c]pyridine-2-carbaldehyde |
IUPAC Name: | 7-iodofuro[3,2-c]pyridine-2-carbaldehyde |
Description: | 7-Iodofuro[3,2-c]pyridine-2-carbaldehyde (CAS# 342601-33-6) is a useful research chemical. |
Molecular Weight: | 273.03 |
Molecular Formula: | C8H4INO2 |
Canonical SMILES: | C1=C(OC2=C(C=NC=C21)I)C=O |
InChI: | InChI=1S/C8H4INO2/c9-7-3-10-2-5-1-6(4-11)12-8(5)7/h1-4H |
InChI Key: | GUKVIPXWLJIRHL-UHFFFAOYSA-N |
LogP: | 2.24490 |
Publication Number | Title | Priority Date |
EP-2876109-A1 | Fused ring compound containing furan or salt thereof and pharmaceutical composition comprising same | 20120723 |
US-2015191478-A1 | Fused ring compound containing furan or salt thereof and pharmaceutical composition comprising same | 20120723 |
US-9493478-B2 | Fused ring compound containing furan or salt thereof and pharmaceutical composition comprising same | 20120723 |
EP-1838706-A1 | G-protein coupled receptor agonists | 20041224 |
JP-2008525417-A | G protein-coupled receptor agonist | 20041224 |
Complexity: | 188 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 272.92868 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 272.92868 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 43.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS