7-Hydroxy-4-methyl-1-indanone - CAS 67901-82-0
Catalog: |
BB033436 |
Product Name: |
7-Hydroxy-4-methyl-1-indanone |
CAS: |
67901-82-0 |
Synonyms: |
7-hydroxy-4-methyl-2,3-dihydroinden-1-one |
IUPAC Name: | 7-hydroxy-4-methyl-2,3-dihydroinden-1-one |
Description: | 7-Hydroxy-4-methyl-1-indanone (CAS# 67901-82-0 ) is a useful research chemical. |
Molecular Weight: | 162.19 |
Molecular Formula: | C10H10O2 |
Canonical SMILES: | CC1=C2CCC(=O)C2=C(C=C1)O |
InChI: | InChI=1S/C10H10O2/c1-6-2-4-8(11)10-7(6)3-5-9(10)12/h2,4,11H,3,5H2,1H3 |
InChI Key: | FXEWVKMVYBQMET-UHFFFAOYSA-N |
Boiling Point: | 339.3 ℃ at 760 mmHg |
Density: | 1.25 g/cm3 |
Appearance: | White to brown solid |
LogP: | 1.82950 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P312, P305+P351+P338, P330, P337+P313, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
EP-2764052-A2 | Iron(iii) containing complex and condensation reaction catalysts, methods for preparing the catalysts, and compositions containing the catalysts | 20111004 |
EP-2764052-B1 | Iron(iii) containing complex and condensation reaction catalysts, methods for preparing the catalysts, and compositions containing the catalysts | 20111004 |
JP-2014529003-A | Iron (III) -containing complex and condensation reaction catalyst, method for preparing the catalyst, and composition containing the catalyst | 20111004 |
JP-6166266-B2 | Iron (III) -containing complex and condensation reaction catalyst, method for preparing the catalyst, and composition containing the catalyst | 20111004 |
US-2014371056-A1 | Iron(III) Containing Complex and Condensation Reaction Catalysts, Methods for Preparing the Catalysts, and Compositions Containing the Catalysts | 20111004 |
Complexity: | 200 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 162.068079557 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 162.068079557 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 37.3 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS