7-Fluoroindole-3-acetic Acid - CAS 170893-02-4
Catalog: |
BB012679 |
Product Name: |
7-Fluoroindole-3-acetic Acid |
CAS: |
170893-02-4 |
Synonyms: |
2-(7-fluoro-1H-indol-3-yl)acetic acid; 2-(7-fluoro-1H-indol-3-yl)acetic acid |
IUPAC Name: | 2-(7-fluoro-1H-indol-3-yl)acetic acid |
Description: | 7-Fluoroindole-3-acetic Acid (CAS# 170893-02-4 ) is a useful research chemical. |
Molecular Weight: | 193.17 |
Molecular Formula: | C10H8FNO2 |
Canonical SMILES: | C1=CC2=C(C(=C1)F)NC=C2CC(=O)O |
InChI: | InChI=1S/C10H8FNO2/c11-8-3-1-2-7-6(4-9(13)14)5-12-10(7)8/h1-3,5,12H,4H2,(H,13,14) |
InChI Key: | MXEHCUNCVQVBQL-UHFFFAOYSA-N |
LogP: | 1.93410 |
Publication Number | Title | Priority Date |
US-2020262819-A1 | Benzoimidazole indolyl methanes and methods of using them to inhibit pcks9 and pcks9-mediated ailments | 20190215 |
CN-103621505-A | Application of halogenated indole-3-acetic acid as herbicide | 20131118 |
WO-2014060596-A1 | Process for preparing indole derivatives | 20121018 |
US-2008196124-A1 | Plant Growth Hormone Regulated Transcription Factors and Promoters Thereof | 20060427 |
WO-2007127923-A2 | Plant growth hormone regulated transcription factors and promoters thereof | 20060427 |
PMID | Publication Date | Title | Journal |
17481907 | 20070701 | Binding of ring-substituted indole-3-acetic acids to human serum albumin | Bioorganic & medicinal chemistry |
15501568 | 20041101 | Absorption and fluorescence spectra of ring-substituted indole-3-acetic acids | Biophysical chemistry |
Complexity: | 234 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 193.05390666 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 193.05390666 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 53.1 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS