7-Ethynyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine - CAS 1823353-88-3
Catalog: |
BB013916 |
Product Name: |
7-Ethynyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
CAS: |
1823353-88-3 |
Synonyms: |
7-ethynyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine; 7-ethynyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
IUPAC Name: | 7-ethynyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine |
Description: | 7-Ethynyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine (CAS# 1823353-88-3 ) is a useful research chemical. |
Molecular Weight: | 160.17 |
Molecular Formula: | C9H8N2O |
Canonical SMILES: | C#CC1=CC2=C(N=C1)OCCN2 |
InChI: | InChI=1S/C9H8N2O/c1-2-7-5-8-9(11-6-7)12-4-3-10-8/h1,5-6,10H,3-4H2 |
InChI Key: | FFDFLEAMTRKUKU-UHFFFAOYSA-N |
LogP: | 1.00520 |
Publication Number | Title | Priority Date |
US-2020223827-A1 | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
US-2020223844-A1 | Triazolopyridin-3-ones or their salts and pharmaceutical compositions comprising the same | 20181214 |
TW-202039447-A | 3,3-difluoroallylamines or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
KR-20210092312-A | 3,3-difluoroallylamine or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
KR-20210092314-A | Triazolopyridin-3-one or salts thereof and pharmaceutical compositions comprising the same | 20181214 |
Complexity: | 208 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 160.063662883 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 160.063662883 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 34.2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.2 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS