7-Bromoisatin - CAS 20780-74-9
Catalog: |
BB016291 |
Product Name: |
7-Bromoisatin |
CAS: |
20780-74-9 |
Synonyms: |
7-bromo-1H-indole-2,3-dione |
IUPAC Name: | 7-bromo-1H-indole-2,3-dione |
Description: | 7-Bromoisatin (CAS# 20780-74-9) is a useful research chemical. |
Molecular Weight: | 226.03 |
Molecular Formula: | C8H4BrNO2 |
Canonical SMILES: | C1=CC2=C(C(=C1)Br)NC(=O)C2=O |
InChI: | InChI=1S/C8H4BrNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12) |
InChI Key: | OCVKSIWBTJCXPV-UHFFFAOYSA-N |
Melting Point: | 199 ℃ |
Purity: | 98 % |
Density: | 1.826 g/cm3 |
Appearance: | White to brown to red solid |
MDL: | MFCD00774354 |
LogP: | 1.72190 |
GHS Hazard Statement: | H302 (86.67%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P310, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
CN-111777619-A | 2-oxo spiro [ indoline-3, 4' -pyran ] ketone compound and synthesis method and application thereof | 20200814 |
CN-111574426-A | Diamine monomer containing isoindigo structure and black polyimide synthesized from diamine monomer | 20200527 |
CN-111187233-A | Polysubstituted benzothiazole and derivative and synthesis method thereof | 20200118 |
CN-110964018-A | Indole derivative and application thereof | 20191203 |
CN-110256407-A | One kind -3- hydroxyl oxoindole derivative of substitution containing pyrazolone and preparation method | 20190628 |
PMID | Publication Date | Title | Journal |
22363221 | 20120101 | Marine compounds selectively induce apoptosis in female reproductive cancer cells but not in primary-derived human reproductive granulosa cells | Marine drugs |
20056518 | 20100301 | QSAR study of isatin analogues as in vitro anti-cancer agents | European journal of medicinal chemistry |
19924760 | 20091201 | Investigation of trypanothione reductase as a drug target in Trypanosoma brucei | ChemMedChem |
17088067 | 20070115 | In vitro cytotoxicity evaluation of some substituted isatin derivatives | Bioorganic & medicinal chemistry |
Complexity: | 241 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 224.94254 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 224.94254 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 46.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indoles
Indolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS