7-Bromo-2-chloroquinoline - CAS 99455-15-9
Catalog: |
BB042292 |
Product Name: |
7-Bromo-2-chloroquinoline |
CAS: |
99455-15-9 |
Synonyms: |
2-Chloro-7-bromoquinoline; 7-Bromo-2-chloro-quinoline; Quinoline, 7-bromo-2-chloro- |
IUPAC Name: | 7-bromo-2-chloroquinoline |
Molecular Weight: | 242.50 |
Molecular Formula: | C9H5BrClN |
Canonical SMILES: | C1=CC(=CC2=C1C=CC(=N2)Cl)Br |
InChI: | InChI=1S/C9H5BrClN/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5H |
InChI Key: | MOEWRAKNXMILKB-UHFFFAOYSA-N |
Boiling Point: | 325.7±22.0°C (Predicted) |
Melting Point: | 120-121°C |
Purity: | ≥95% |
Density: | 1.673 g/cm3 |
Appearance: | Solid |
Storage: | Store at RT |
LogP: | 3.65070 |
GHS Hazard Statement: | H301 (95.12%): Toxic if swallowed [Danger Acute toxicity, oral] |
Precautionary Statement: | P264, P270, P280, P301+P310, P305+P351+P338, P310, P321, P330, P405, and P501 |
Signal Word: | Danger |
Publication Number | Title | Priority Date |
WO-2021018023-A1 | Small molecule glp-1 receptor modulator | 20190801 |
WO-2020206308-A1 | Selective inhibitors of protein arginine methyltransferase 5 | 20190405 |
WO-2020033282-A1 | Prmt5 inhibitors | 20180807 |
WO-2020033284-A1 | Prmt5 inhibitors | 20180807 |
EP-3833667-A1 | Prmt5 inhibitors | 20180807 |
Complexity: | 165 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 240.92939 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 240.92939 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 12.9 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 3.8 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Quinoline/Isoquinoline
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS