7-Amino-4-methylquinoline - CAS 114058-79-6
Catalog: |
BB003295 |
Product Name: |
7-Amino-4-methylquinoline |
CAS: |
114058-79-6 |
Synonyms: |
4-methyl-7-quinolinamine; 4-methylquinolin-7-amine |
IUPAC Name: | 4-methylquinolin-7-amine |
Description: | 7-Amino-4-methylquinoline (CAS# 114058-79-6) is a useful research chemical. |
Molecular Weight: | 158.20 |
Molecular Formula: | C10H10N2 |
Canonical SMILES: | CC1=C2C=CC(=CC2=NC=C1)N |
InChI: | InChI=1S/C10H10N2/c1-7-4-5-12-10-6-8(11)2-3-9(7)10/h2-6H,11H2,1H3 |
InChI Key: | MEWHVQCJPFDWIO-UHFFFAOYSA-N |
LogP: | 2.70660 |
Publication Number | Title | Priority Date |
AU-2013258223-B2 | Bicyclically substituted uracils and the use thereof | 20120509 |
AU-2017265047-A1 | Bicyclically substituted uracils and the use thereof | 20120509 |
AU-2017265047-B2 | Bicyclically substituted uracils and the use thereof | 20120509 |
CA-2872906-A1 | Bicyclically substituted uracils and the use thereof | 20120509 |
CN-104395310-B | Bicyclically substituted uracils and the use thereof | 20120509 |
PMID | Publication Date | Title | Journal |
2838633 | 19880701 | 7-Aminoquinolines. A novel class of agents active against herpesviruses | Journal of medicinal chemistry |
Complexity: | 158 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 158.084398327 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 158.084398327 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Amines and Anilines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS