7-Amino-4-methyl-1H-indole-3-carbonitrile - CAS 289483-87-0
Catalog: |
BB020024 |
Product Name: |
7-Amino-4-methyl-1H-indole-3-carbonitrile |
CAS: |
289483-87-0 |
Synonyms: |
7-amino-4-methyl-1H-indole-3-carbonitrile; 7-amino-4-methyl-1H-indole-3-carbonitrile |
IUPAC Name: | 7-amino-4-methyl-1H-indole-3-carbonitrile |
Description: | 7-Amino-4-methyl-1H-indole-3-carbonitrile (CAS# 289483-87-0) is a useful research chemical compound. |
Molecular Weight: | 171.20 |
Molecular Formula: | C10H9N3 |
Canonical SMILES: | CC1=C2C(=CNC2=C(C=C1)N)C#N |
InChI: | InChI=1S/C10H9N3/c1-6-2-3-8(12)10-9(6)7(4-11)5-13-10/h2-3,5,13H,12H2,1H3 |
InChI Key: | SHVBJIBHAKCNMY-UHFFFAOYSA-N |
LogP: | 2.51138 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2021157684-A1 | Sulfonamide or sulfinamide compound having effect of inducing brd4 protein degradation and pharmaceutical use thereof | 20200206 |
KR-20210076879-A | Novel pyrimidine derivatives and use thereof | 20191216 |
WO-2021125803-A1 | Novel pyrimidin derivative and use thereof | 20191216 |
CN-112409376-A | Protein degradation targeting chimera based on DCAF15, and preparation method and application thereof | 20190820 |
JP-2020186182-A | Target proteolysis-inducing compound | 20190510 |
Complexity: | 242 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 171.079647300 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 171.079647300 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 65.6 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Nitrogen Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS