6-Nitroindolin-2-one - CAS 474799-41-2
Catalog: |
BB026313 |
Product Name: |
6-Nitroindolin-2-one |
CAS: |
474799-41-2 |
Synonyms: |
6-nitro-1,3-dihydroindol-2-one; 6-nitro-1,3-dihydroindol-2-one |
IUPAC Name: | 6-nitro-1,3-dihydroindol-2-one |
Description: | 6-Nitroindolin-2-one (CAS# 474799-41-2) is a useful research chemical. |
Molecular Weight: | 178.14 |
Molecular Formula: | C8H6N2O3 |
Canonical SMILES: | C1C2=C(C=C(C=C2)[N+](=O)[O-])NC1=O |
InChI: | InChI=1S/C8H6N2O3/c11-8-3-5-1-2-6(10(12)13)4-7(5)9-8/h1-2,4H,3H2,(H,9,11) |
InChI Key: | WYCVARGVMCGNMC-UHFFFAOYSA-N |
Boiling Point: | 390.6 °C at 760 mmHg |
Density: | 1.449 g/cm3 |
MDL: | MFCD09835636 |
LogP: | 1.69770 |
Publication Number | Title | Priority Date |
US-2016060260-A1 | Bromodomain inhibitors for treating disease | 20140829 |
CA-2690567-A1 | 3-hetrocyclylidene-indolinone derivatives as inhibitors of specific cell cycle kinases | 20070612 |
CA-2690569-A1 | Indolinone derivatives and their use in treating disease-states such as cancer | 20070612 |
EP-2167465-A1 | Indolinone derivatives and their use in treating disease-states such as cancer | 20070612 |
EP-2181108-A2 | 3-hetrocyclylidene-indolinone derivatives as inhibitors of specific cell cycle kinases | 20070612 |
Complexity: | 248 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 178.03784206 |
Formal Charge: | 0 |
Heavy Atom Count: | 13 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 178.03784206 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 74.9 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Indolines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS