6-Methylthieno[3,2-d]pyrimidine-2,4(1H,3H)-dione - CAS 35265-80-6
Catalog: |
BB022583 |
Product Name: |
6-Methylthieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
CAS: |
35265-80-6 |
Synonyms: |
6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione; 6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
IUPAC Name: | 6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
Description: | 6-Methylthieno[3,2-d]pyrimidine-2,4(1H,3H)-dione (CAS# 35265-80-6 ) is a useful research chemical. |
Molecular Weight: | 182.20 |
Molecular Formula: | C7H6N2O2S |
Canonical SMILES: | CC1=CC2=C(S1)C(=O)NC(=O)N2 |
InChI: | InChI=1S/C7H6N2O2S/c1-3-2-4-5(12-3)6(10)9-7(11)8-4/h2H,1H3,(H2,8,9,10,11) |
InChI Key: | PIZHAUJWNOWGDX-UHFFFAOYSA-N |
LogP: | 1.41090 |
Publication Number | Title | Priority Date |
US-2017096435-A1 | Sepiapterin reductase inhibitors | 20150930 |
US-9963462-B2 | Sepiapterin reductase inhibitors | 20150930 |
US-2014323466-A1 | Thienyl [3,2-d] pyrimidin-4-one compounds, preparation method, pharmaceutical compositions and use thereof | 20111201 |
US-9045491-B2 | Thienyl [3,2-D] pyrimidin-4-one compounds, preparation method, pharmaceutical compositions and use thereof | 20111201 |
WO-2013078765-A1 | Thienyl [3, 2-d] pyrimidin-4-one compounds, preparation method, pharmaceutical compositions and use thereof | 20111201 |
Complexity: | 244 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 182.01499861 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 182.01499861 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 86.4 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS