6-Methylmorpholin-3-one - CAS 127958-63-8
Catalog: |
BB006844 |
Product Name: |
6-Methylmorpholin-3-one |
CAS: |
127958-63-8 |
Synonyms: |
6-methyl-3-morpholinone; 6-methylmorpholin-3-one |
IUPAC Name: | 6-methylmorpholin-3-one |
Description: | 6-Methylmorpholin-3-one (CAS# 127958-63-8) is a useful research chemical. |
Molecular Weight: | 115.13 |
Molecular Formula: | C5H9NO2 |
Canonical SMILES: | CC1CNC(=O)CO1 |
InChI: | InChI=1S/C5H9NO2/c1-4-2-6-5(7)3-8-4/h4H,2-3H2,1H3,(H,6,7) |
InChI Key: | SKUDAELDAIZDDT-UHFFFAOYSA-N |
Storage: | Sealed in dry, Room Temperature |
LogP: | -0.20280 |
Publication Number | Title | Priority Date |
WO-2020115501-A1 | Pharmaceutical compounds and their use as inhibitors of ubiquitin specific protease 19 (usp19) | 20181206 |
EP-3890829-A1 | Pharmaceutical compounds and their use as inhibitors of ubiquitin specific protease 19 (usp19) | 20181206 |
WO-2019150119-A1 | 4-hydroxypiperidine derivatives and their use as inhibitors of ubiquitin specific protease 19 (usp19) | 20180131 |
AU-2019213562-A1 | 4-hydroxypiperidine derivatives and their use as inhibitors of ubiquitin specific protease 19 (USP19) | 20180131 |
EP-3746432-A1 | 4-hydroxypiperidine derivatives and their use as inhibitors of ubiquitin specific protease 19 (usp19) | 20180131 |
Complexity: | 103 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 115.06332853 |
Formal Charge: | 0 |
Heavy Atom Count: | 8 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 115.06332853 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 38.3 |
Undefined Atom Stereocenter Count: | 1 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | -0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS