6-Methyl-2-pyridinemethanol - CAS 1122-71-0
Catalog: |
BB002917 |
Product Name: |
6-Methyl-2-pyridinemethanol |
CAS: |
1122-71-0 |
Synonyms: |
(6-methylpyridin-2-yl)methanol |
IUPAC Name: | (6-methylpyridin-2-yl)methanol |
Description: | 6-Methyl-2-pyridinemethanol (CAS# 1122-71-0) is a useful research chemical. |
Molecular Weight: | 123.15 |
Molecular Formula: | C7H9NO |
Canonical SMILES: | CC1=NC(=CC=C1)CO |
InChI: | InChI=1S/C7H9NO/c1-6-3-2-4-7(5-9)8-6/h2-4,9H,5H2,1H3 |
InChI Key: | JLVBSBMJQUMAMW-UHFFFAOYSA-N |
Boiling Point: | 105-108 °C (12 mmHg) |
Density: | 1.092 g/cm3 |
Appearance: | Colorless or white to yellow |
Storage: | Inert atmosphere, Room Temperature |
MDL: | MFCD00023520 |
LogP: | 0.88230 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112707902-A | TGF-beta receptor inhibitors | 20200323 |
US-2021061809-A1 | Triazolopyrimidines as a2a / a2b inhibitors | 20190826 |
WO-2021041360-A1 | Triazolopyrimidines as a2a / a2b inhibitors | 20190826 |
US-2020270244-A1 | Pyrazolopyridines and triazolopyridines as a2a / a2b inhibitors | 20190129 |
WO-2020159905-A1 | Pyrazolopyridines and triazolopyridines as a2a / a2b inhibitors | 20190129 |
PMID | Publication Date | Title | Journal |
18563881 | 20080721 | Synthesis, structure, and reactivity of rhodium and iridium complexes of the chelating bis-sulfoxide tBuSOC2H4SOtBu. Selective O-H activation of 2-hydroxy-isopropyl-pyridine | Inorganic chemistry |
18069829 | 20080107 | Helicates, boxes, and polymers from simple pyridine-alcohol ligands: the impact of the identity of the transition metal ion | Inorganic chemistry |
16749821 | 20060612 | Boxes, helicates, and coordination polymers: a structural and magnetochemical investigation of the diverse coordination chemistry of simple pyridine-alcohol ligands | Inorganic chemistry |
15551322 | 20041217 | The versatile, efficient, and stereoselective self-assembly of transition-metal helicates by using hydrogen-bonds | Chemistry (Weinheim an der Bergstrasse, Germany) |
11511205 | 20010827 | Mixed-valence tetranuclear manganese single-molecule magnets | Inorganic chemistry |
Complexity: | 85 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 123.068413911 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 123.068413911 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 33.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Pyridines
Customers Also Viewed
-
[891016-02-7]
ML-SI3
-
[30879-49-3]
2'-Nitro-5'-hydroxyacetophenone
-
[75726-96-4]
2-Bromo-N-isopropylacetamide
-
[132182-92-4]
Pentane, 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)-
-
[1184173-73-6]
MK-8353
-
[24292-52-2]
Hesperidin methyl chalcone
INDUSTRY LEADERS TRUST OUR PRODUCTS