6-Methyl-1H,2H,3H-pyrido[2,3-b][1,4]oxazin-2-one (>90%) - CAS 1198153-91-1
Catalog: |
BB059540 |
Product Name: |
6-Methyl-1H,2H,3H-pyrido[2,3-b][1,4]oxazin-2-one (>90%) |
CAS: |
1198153-91-1 |
Synonyms: |
6-methyl-1H,2H,3H-pyrido[2,3-b][1,4]oxazin-2-one; 6-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
IUPAC Name: | 6-methyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
Description: | 6-methyl-1H,2H,3H-pyrido[2,3-b][1,4]oxazin-2-one (cas# 1198153-91-1) is a useful research chemical. |
Molecular Weight: | 164.16 |
Molecular Formula: | C8H8N2O2 |
Canonical SMILES: | CC1=NC2=C(C=C1)NC(=O)CO2 |
InChI: | InChI=1S/C8H8N2O2/c1-5-2-3-6-8(9-5)12-4-7(11)10-6/h2-3H,4H2,1H3,(H,10,11) |
InChI Key: | OBKUXCCMPCVLGB-UHFFFAOYSA-N |
Melting Point: | >195°C (dec.) |
Solubility: | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) |
Appearance: | Dark Brown Solid |
Storage: | -20°C Freezer, Under inert atmosphere |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P264+P265, P270, P271, P280, P301+P317, P302+P352, P304+P340, P305+P351+P338, P319, P321, P330, P332+P317, P337+P317, P362+P364, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2019243526-A1 | Oga inhibitor compounds | 20180620 |
WO-2019243527-A1 | Oga inhibitor compounds | 20180620 |
US-2017202970-A1 | Silicon based drug conjugates and methods of using same | 20150512 |
EP-3027601-B1 | Syk inhibitors | 20130731 |
US-10005774-B2 | Syk inhibitors | 20130731 |
WO-2015017610-A1 | Syk inhibitors | 20130731 |
AU-2009252166-A1 | Heterocyclic derivatives | 20080331 |
AU-2009252166-B2 | Heterocyclic derivatives | 20080331 |
AU-2009252166-B9 | Heterocyclic derivatives | 20080331 |
CA-2718709-A1 | Heterocyclic derivatives | 20080331 |
Complexity: | 196 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 164.058577502 |
Formal Charge: | 0 |
Heavy Atom Count: | 12 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 164.058577502 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 51.2Ų |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.5 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Other Building Blocks
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS