6-Methoxyquinoline-4-carbaldehyde - CAS 4363-94-4
Catalog: |
BB025442 |
Product Name: |
6-Methoxyquinoline-4-carbaldehyde |
CAS: |
4363-94-4 |
Synonyms: |
6-methoxy-4-quinolinecarboxaldehyde; 6-methoxyquinoline-4-carbaldehyde |
IUPAC Name: | 6-methoxyquinoline-4-carbaldehyde |
Description: | 6-Methoxyquinoline-4-carbaldehyde (CAS# 4363-94-4) is a useful reactant for the synthesis of tetrahydropyran-based bacterial topoisomerase inhibitors. |
Molecular Weight: | 187.19 |
Molecular Formula: | C11H9NO2 |
Canonical SMILES: | COC1=CC2=C(C=CN=C2C=C1)C=O |
InChI: | InChI=1S/C11H9NO2/c1-14-9-2-3-11-10(6-9)8(7-13)4-5-12-11/h2-7H,1H3 |
InChI Key: | PDGKZDPIWAKVLH-UHFFFAOYSA-N |
Boiling Point: | 353.7 ℃ at 760 mmHg |
Density: | 1.227 g/cm3 |
MDL: | MFCD06824393 |
LogP: | 2.05590 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
KR-101891834-B1 | Tricyclic antibiotics | 20091218 |
AU-2009207421-A1 | Fused pyridines active as inhibitors of c-Met | 20080125 |
AU-2008337096-A1 | 5-aminocyclylmethyl-oxazolidin-2-one derivatives | 20071218 |
AU-2008337096-B2 | 5-aminocyclylmethyl-oxazolidin-2-one derivatives | 20071218 |
CA-2706837-A1 | 5-aminocyclylmethyl-oxazolidin-2-one derivatives | 20071218 |
Complexity: | 208 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 187.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 14 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 187.063328530 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 39.2 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.6 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS