(6-Methoxy-pyridin-2-yl)-methanol - CAS 63071-12-5
Catalog: |
BB031983 |
Product Name: |
(6-Methoxy-pyridin-2-yl)-methanol |
CAS: |
63071-12-5 |
Synonyms: |
(6-methoxypyridin-2-yl)methanol |
IUPAC Name: | (6-methoxypyridin-2-yl)methanol |
Description: | (6-Methoxy-pyridin-2-yl)-methanol (CAS# 63071-12-5) is a useful research chemical. |
Molecular Weight: | 139.15 |
Molecular Formula: | C7H9NO2 |
Canonical SMILES: | COC1=CC=CC(=N1)CO |
InChI: | InChI=1S/C7H9NO2/c1-10-7-4-2-3-6(5-9)8-7/h2-4,9H,5H2,1H3 |
InChI Key: | OPXGBIUWGAUTER-UHFFFAOYSA-N |
Boiling Point: | 235.3 °C at 760 mmHg |
Purity: | 95 % |
Density: | 1.155 g/cm3 |
MDL: | MFCD08235128 |
LogP: | 0.58250 |
GHS Hazard Statement: | H315 (100%): Causes skin irritation [Warning Skin corrosion/irritation] |
Precautionary Statement: | P261, P264, P271, P280, P302+P352, P304+P340, P305+P351+P338, P312, P321, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
WO-2020160711-A1 | Imidazo [2, 1-f] [1, 2, 4] triazin-4-amine derivatives as tlr7 agonist | 20190207 |
TW-202045508-A | Imidazo[2,1-f][1,2,4]triazin-4-amine derivatives as tlr7 agonist | 20190207 |
WO-2020156453-A1 | Pyrimidinyl group-containing tricyclic compound serving as c-met inhibitor | 20190201 |
WO-2020153433-A1 | Substituent-including urea compound | 20190124 |
TW-202043239-A | Urea compounds with substituents | 20190124 |
Complexity: | 97.6 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 139.063328530 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 139.063328530 |
Rotatable Bond Count: | 2 |
Topological Polar Surface Area: | 42.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.3 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Pyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS