6-Fluoro-4-hydroxyquinoline-3-carboxylic Acid - CAS 343-10-2
Catalog: |
BB022067 |
Product Name: |
6-Fluoro-4-hydroxyquinoline-3-carboxylic Acid |
CAS: |
343-10-2 |
Synonyms: |
6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid; 6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
IUPAC Name: | 6-fluoro-4-oxo-1H-quinoline-3-carboxylic acid |
Description: | 6-Fluoro-4-hydroxyquinoline-3-carboxylic Acid (CAS# 343-10-2) is a useful research chemical. |
Molecular Weight: | 207.16 |
Molecular Formula: | C10H6FNO3 |
Canonical SMILES: | C1=CC2=C(C=C1F)C(=O)C(=CN2)C(=O)O |
InChI: | InChI=1S/C10H6FNO3/c11-5-1-2-8-6(3-5)9(13)7(4-12-8)10(14)15/h1-4H,(H,12,13)(H,14,15) |
InChI Key: | KCEJQAATYWQMMQ-UHFFFAOYSA-N |
Boiling Point: | 362.7 ℃ at 760 mmHg |
Density: | 1.517 g/cm3 |
MDL: | MFCD00973836 |
LogP: | 1.77770 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P312, P304+P340, P305+P351+P338, P312, P321, P322, P330, P332+P313, P337+P313, P362, P363, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-111162313-A | Polymer electrolyte and lithium ion battery | 20191223 |
AU-2017285689-A1 | Novel pyridonecarboxylic acid derivative or salt thereof | 20160615 |
JP-6322772-B1 | Novel pyridonecarboxylic acid derivative or salt thereof | 20160615 |
JP-WO2017217441-A1 | Novel pyridonecarboxylic acid derivative or salt thereof | 20160615 |
WO-2017217441-A1 | Novel pyridonecarboxylic acid derivative or salt thereof | 20160615 |
PMID | Publication Date | Title | Journal |
19507813 | 20090709 | Free-radical-induced oxidative and reductive degradation of fluoroquinolone pharmaceuticals: kinetic studies and degradation mechanism | The journal of physical chemistry. A |
17064064 | 20061102 | Evaluation of 3-carboxy-4(1H)-quinolones as inhibitors of human protein kinase CK2 | Journal of medicinal chemistry |
14642332 | 20031101 | Synthesis of 6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic acid derivatives as potential antimicrobial agents | European journal of medicinal chemistry |
Complexity: | 340 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 207.03317122 |
Formal Charge: | 0 |
Heavy Atom Count: | 15 |
Hydrogen Bond Acceptor Count: | 5 |
Hydrogen Bond Donor Count: | 2 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 207.03317122 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 66.4 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.9 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Carbonyl Compounds
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS