6-Fluoro-2-pyridinemethanol - CAS 315180-17-7
Catalog: |
BB020949 |
Product Name: |
6-Fluoro-2-pyridinemethanol |
CAS: |
315180-17-7 |
Synonyms: |
(6-fluoro-2-pyridinyl)methanol; (6-fluoropyridin-2-yl)methanol |
IUPAC Name: | (6-fluoropyridin-2-yl)methanol |
Description: | 6-Fluoro-2-pyridinemethanol (CAS# 315180-17-7) is a useful research chemical. |
Molecular Weight: | 127.12 |
Molecular Formula: | C6H6FNO |
Canonical SMILES: | C1=CC(=NC(=C1)F)CO |
InChI: | InChI=1S/C6H6FNO/c7-6-3-1-2-5(4-9)8-6/h1-3,9H,4H2 |
InChI Key: | OWTCZNAMUJIMOC-UHFFFAOYSA-N |
Boiling Point: | 218.977 °C at 760 mmHg |
Density: | 1.263 g/cm3 |
MDL: | MFCD07783827 |
LogP: | 0.71300 |
GHS Hazard Statement: | H302 (100%): Harmful if swallowed [Warning Acute toxicity, oral] |
Precautionary Statement: | P261, P264, P270, P271, P280, P301+P312, P302+P352, P304+P340, P305+P351+P338, P312, P321, P330, P332+P313, P337+P313, P362, P403+P233, P405, and P501 |
Signal Word: | Warning |
Publication Number | Title | Priority Date |
CN-112979655-A | Triazolopyridazine derivative, preparation method, pharmaceutical composition and application thereof | 20191216 |
WO-2021121294-A1 | Triazolopyridazine derivative, preparation method therefor, pharmaceutical composition thereof, and use thereof | 20191216 |
WO-2020247804-A1 | Heterocycle substituted pyridine derivative antifungal agents | 20190607 |
WO-2020243459-A1 | Thiadiazolyl derivatives as dna polymerase theta inhibitors | 20190531 |
WO-2020097389-A1 | Bicyclic compounds | 20181109 |
Complexity: | 89.1 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 127.043341977 |
Formal Charge: | 0 |
Heavy Atom Count: | 9 |
Hydrogen Bond Acceptor Count: | 3 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 127.043341977 |
Rotatable Bond Count: | 1 |
Topological Polar Surface Area: | 33.1 Å2 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 0.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Alcohols and Derivatives
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS