6-Chloroimidazo[1,2-a]pyridine - CAS 6188-25-6
Catalog: |
BB031305 |
Product Name: |
6-Chloroimidazo[1,2-a]pyridine |
CAS: |
6188-25-6 |
Synonyms: |
6-chloroimidazo[1,2-a]pyridine; 6-chloroimidazo[1,2-a]pyridine |
IUPAC Name: | 6-chloroimidazo[1,2-a]pyridine |
Description: | 6-Chloroimidazo[1,2-a]pyridine (CAS# 6188-25-6) is a useful research chemical. |
Molecular Weight: | 152.58 |
Molecular Formula: | C7H5ClN2 |
Canonical SMILES: | C1=CC2=NC=CN2C=C1Cl |
InChI: | InChI=1S/C7H5ClN2/c8-6-1-2-7-9-3-4-10(7)5-6/h1-5H |
InChI Key: | XQEGYCZJSVFGEE-UHFFFAOYSA-N |
Purity: | 97 % |
Density: | 1.35 g/cm3 |
MDL: | MFCD05663807 |
LogP: | 1.98770 |
Publication Number | Title | Priority Date |
US-2020309707-A1 | Reagent and kit for enhancing chemiluminescent reaction | 20190328 |
US-11112366-B2 | Reagent and kit for enhancing chemiluminescent reaction | 20190328 |
WO-2020083878-A1 | 5-azaindazole derivatives as adenosine receptor antagonists | 20181025 |
CN-112867715-A | 5-azaindazole derivatives as adenosine receptor antagonists | 20181025 |
EP-3870582-A1 | 5-azaindazole derivatives as adenosine receptor antagonists | 20181025 |
Complexity: | 129 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 152.0141259 |
Formal Charge: | 0 |
Heavy Atom Count: | 10 |
Hydrogen Bond Acceptor Count: | 1 |
Hydrogen Bond Donor Count: | 0 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 152.0141259 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 17.3 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 2.4 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Imidazopyridines
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS