6-Chloro-7-methyl-1H-imidazo[4,5-b]pyridine - CAS 893566-44-4
Catalog: |
BB039437 |
Product Name: |
6-Chloro-7-methyl-1H-imidazo[4,5-b]pyridine |
CAS: |
893566-44-4 |
Synonyms: |
6-chloro-7-methyl-1H-imidazo[4,5-b]pyridine; 6-chloro-7-methyl-1H-imidazo[4,5-b]pyridine |
IUPAC Name: | 6-chloro-7-methyl-1H-imidazo[4,5-b]pyridine |
Description: | 6-Chloro-7-methyl-1H-imidazo[4,5-b]pyridine (CAS# 893566-44-4) is a useful research chemical. |
Molecular Weight: | 167.60 |
Molecular Formula: | C7H6ClN3 |
Canonical SMILES: | CC1=C2C(=NC=C1Cl)N=CN2 |
InChI: | InChI=1S/C7H6ClN3/c1-4-5(8)2-9-7-6(4)10-3-11-7/h2-3H,1H3,(H,9,10,11) |
InChI Key: | FFNUNCZPNJGSCF-UHFFFAOYSA-N |
LogP: | 1.91970 |
Publication Number | Title | Priority Date |
WO-2021032148-A1 | Aminopyrazine compounds as hpk1 inhibitor and the use thereof | 20190821 |
AU-2018218965-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
AU-2018218965-B2 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
EP-3580208-A1 | Novel heterocyclic compound, its preparation method, and pharmaceutical composition comprising the same | 20170207 |
JP-2020506197-A | Novel heterocyclic compound, production method thereof and pharmaceutical composition containing the same | 20170207 |
Complexity: | 153 |
Compound Is Canonicalized: | Yes |
Covalently-Bonded Unit Count: | 1 |
Defined Atom Stereocenter Count: | 0 |
Defined Bond Stereocenter Count: | 0 |
Exact Mass: | 167.0250249 |
Formal Charge: | 0 |
Heavy Atom Count: | 11 |
Hydrogen Bond Acceptor Count: | 2 |
Hydrogen Bond Donor Count: | 1 |
Isotope Atom Count: | 0 |
Monoisotopic Mass: | 167.0250249 |
Rotatable Bond Count: | 0 |
Topological Polar Surface Area: | 41.6 |
Undefined Atom Stereocenter Count: | 0 |
Undefined Bond Stereocenter Count: | 0 |
XLogP3: | 1.7 |
Online Inquiry
Customer Support
Customer Centered
Related Functional Groups
Benzimidazoles
Customers Also Viewed
INDUSTRY LEADERS TRUST OUR PRODUCTS